C12H20BrN5O — CID 103968793
[1-[[(5-bromo-2-hydrazinylpyrimidin-4-yl)amino]methyl]cyclohexyl]methanol (PubChem CID 103968793) has the molecular formula C12H20BrN5O and a molecular weight of 330.23 g/mol. Its IUPAC name is [1-[[(5-bromo-2-hydrazinylpyrimidin-4-yl)amino]methyl]cyclohexyl]methanol.
| Compound Name | [1-[[(5-bromo-2-hydrazinylpyrimidin-4-yl)amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 103968793 |
| Molecular Formula | C12H20BrN5O |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [1-[[(5-bromo-2-hydrazinylpyrimidin-4-yl)amino]methyl]cyclohexyl]methanol |
| SMILES | NNc1ncc(Br)c(NCC2(CO)CCCCC2)n1 |
| InChI | InChI=1S/C12H20BrN5O/c13-9-6-15-11(18-14)17-10(9)16-7-12(8-19)4-2-1-3-5-12/h6,19H,1-5,7-8,14H2,(H2,15,16,17,18) |
| InChIKey | UISQIJBFFMBXEK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|