C14H22BrN3O — CID 104507130
[1-[[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]methyl]cyclohexyl]methanol (PubChem CID 104507130) has the molecular formula C14H22BrN3O and a molecular weight of 328.25 g/mol. Its IUPAC name is [1-[[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]methyl]cyclohexyl]methanol.
| Compound Name | [1-[[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 104507130 |
| Molecular Formula | C14H22BrN3O |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | [1-[[(5-amino-3-bromo-4-methyl-2-pyridinyl)amino]methyl]cyclohexyl]methanol |
| SMILES | Cc1c(N)cnc(NCC2(CO)CCCCC2)c1Br |
| InChI | InChI=1S/C14H22BrN3O/c1-10-11(16)7-17-13(12(10)15)18-8-14(9-19)5-3-2-4-6-14/h7,19H,2-6,8-9,16H2,1H3,(H,17,18) |
| InChIKey | XYVXWYWRMCLIOR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |