C12H16BrClN2O — CID 114836032
[1-[[(3-bromo-5-chloro-2-pyridinyl)amino]methyl]cyclopentyl]methanol (PubChem CID 114836032) has the molecular formula C12H16BrClN2O and a molecular weight of 319.63 g/mol. Its IUPAC name is [1-[[(3-bromo-5-chloro-2-pyridinyl)amino]methyl]cyclopentyl]methanol.
| Compound Name | [1-[[(3-bromo-5-chloro-2-pyridinyl)amino]methyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 114836032 |
| Molecular Formula | C12H16BrClN2O |
| Molecular Weight | 319.63 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | [1-[[(3-bromo-5-chloro-2-pyridinyl)amino]methyl]cyclopentyl]methanol |
| SMILES | OCC1(CNc2ncc(Cl)cc2Br)CCCC1 |
| InChI | InChI=1S/C12H16BrClN2O/c13-10-5-9(14)6-15-11(10)16-7-12(8-17)3-1-2-4-12/h5-6,17H,1-4,7-8H2,(H,15,16) |
| InChIKey | OJNYKSGZJNQVOP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |