C13H19BrClN3 — CID 114838734
N-[[1-(aminomethyl)cyclohexyl]methyl]-3-bromo-5-chloropyridin-2-amine (PubChem CID 114838734) has the molecular formula C13H19BrClN3 and a molecular weight of 332.67 g/mol. Its IUPAC name is N-[[1-(aminomethyl)cyclohexyl]methyl]-3-bromo-5-chloropyridin-2-amine.
| Compound Name | N-[[1-(aminomethyl)cyclohexyl]methyl]-3-bromo-5-chloropyridin-2-amine |
|---|---|
| PubChem CID | 114838734 |
| Molecular Formula | C13H19BrClN3 |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-[[1-(aminomethyl)cyclohexyl]methyl]-3-bromo-5-chloropyridin-2-amine |
| SMILES | NCC1(CNc2ncc(Cl)cc2Br)CCCCC1 |
| InChI | InChI=1S/C13H19BrClN3/c14-11-6-10(15)7-17-12(11)18-9-13(8-16)4-2-1-3-5-13/h6-7H,1-5,8-9,16H2,(H,17,18) |
| InChIKey | ZFOZPWPNBXHXSV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |