C13H17BrClFN2 — CID 114047951
5-bromo-N-[[1-(chloromethyl)cyclohexyl]methyl]-3-fluoropyridin-2-amine (PubChem CID 114047951) has the molecular formula C13H17BrClFN2 and a molecular weight of 335.65 g/mol. Its IUPAC name is 5-bromo-N-[[1-(chloromethyl)cyclohexyl]methyl]-3-fluoropyridin-2-amine.
| Compound Name | 5-bromo-N-[[1-(chloromethyl)cyclohexyl]methyl]-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 114047951 |
| Molecular Formula | C13H17BrClFN2 |
| Molecular Weight | 335.65 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 5-bromo-N-[[1-(chloromethyl)cyclohexyl]methyl]-3-fluoropyridin-2-amine |
| SMILES | Fc1cc(Br)cnc1NCC1(CCl)CCCCC1 |
| InChI | InChI=1S/C13H17BrClFN2/c14-10-6-11(16)12(17-7-10)18-9-13(8-15)4-2-1-3-5-13/h6-7H,1-5,8-9H2,(H,17,18) |
| InChIKey | JSHQWPAZWKGVEI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|