C7H6BrF3N2 — CID 104924591
5-bromo-N-(2,2-difluoroethyl)-3-fluoropyridin-2-amine (PubChem CID 104924591) has the molecular formula C7H6BrF3N2 and a molecular weight of 255.04 g/mol. Its IUPAC name is 5-bromo-N-(2,2-difluoroethyl)-3-fluoropyridin-2-amine.
| Compound Name | 5-bromo-N-(2,2-difluoroethyl)-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 104924591 |
| Molecular Formula | C7H6BrF3N2 |
| Molecular Weight | 255.04 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | 5-bromo-N-(2,2-difluoroethyl)-3-fluoropyridin-2-amine |
| SMILES | Fc1cc(Br)cnc1NCC(F)F |
| InChI | InChI=1S/C7H6BrF3N2/c8-4-1-5(9)7(12-2-4)13-3-6(10)11/h1-2,6H,3H2,(H,12,13) |
| InChIKey | NJKJHDURTOORON-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.04 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |