C10H12BrFN2 — CID 104924312
5-bromo-3-fluoro-N-[(E)-pent-3-enyl]pyridin-2-amine (PubChem CID 104924312) has the molecular formula C10H12BrFN2 and a molecular weight of 259.12 g/mol. Its IUPAC name is 5-bromo-3-fluoro-N-[(E)-pent-3-enyl]pyridin-2-amine.
| Compound Name | 5-bromo-3-fluoro-N-[(E)-pent-3-enyl]pyridin-2-amine |
|---|---|
| PubChem CID | 104924312 |
| Molecular Formula | C10H12BrFN2 |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 5-bromo-3-fluoro-N-[(E)-pent-3-enyl]pyridin-2-amine |
| SMILES | C/C=C/CCNc1ncc(Br)cc1F |
| InChI | InChI=1S/C10H12BrFN2/c1-2-3-4-5-13-10-9(12)6-8(11)7-14-10/h2-3,6-7H,4-5H2,1H3,(H,13,14)/b3-2+ |
| InChIKey | WFXMKMVWKNFSOE-NSCUHMNNSA-N |
| XLogP | 3.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|