C8H7Br2FN2 — CID 104924052
5-bromo-N-(2-bromoprop-2-enyl)-3-fluoropyridin-2-amine (PubChem CID 104924052) has the molecular formula C8H7Br2FN2 and a molecular weight of 309.96 g/mol. Its IUPAC name is 5-bromo-N-(2-bromoprop-2-enyl)-3-fluoropyridin-2-amine.
| Compound Name | 5-bromo-N-(2-bromoprop-2-enyl)-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 104924052 |
| Molecular Formula | C8H7Br2FN2 |
| Molecular Weight | 309.96 g/mol |
| Exact Mass | 307.90 |
| IUPAC Name | 5-bromo-N-(2-bromoprop-2-enyl)-3-fluoropyridin-2-amine |
| SMILES | C=C(Br)CNc1ncc(Br)cc1F |
| InChI | InChI=1S/C8H7Br2FN2/c1-5(9)3-12-8-7(11)2-6(10)4-13-8/h2,4H,1,3H2,(H,12,13) |
| InChIKey | WJMBGEIBEPWROM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.96 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |