C9H10Br2N2 — CID 105367126
3-bromo-N-(2-bromoprop-2-enyl)-5-methylpyridin-2-amine (PubChem CID 105367126) has the molecular formula C9H10Br2N2 and a molecular weight of 306.00 g/mol. Its IUPAC name is 3-bromo-N-(2-bromoprop-2-enyl)-5-methylpyridin-2-amine.
| Compound Name | 3-bromo-N-(2-bromoprop-2-enyl)-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 105367126 |
| Molecular Formula | C9H10Br2N2 |
| Molecular Weight | 306.00 g/mol |
| Exact Mass | 303.92 |
| IUPAC Name | 3-bromo-N-(2-bromoprop-2-enyl)-5-methylpyridin-2-amine |
| SMILES | C=C(Br)CNc1ncc(C)cc1Br |
| InChI | InChI=1S/C9H10Br2N2/c1-6-3-8(11)9(12-4-6)13-5-7(2)10/h3-4H,2,5H2,1H3,(H,12,13) |
| InChIKey | XRWQPAMUTMOMMN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.00 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |