C11H17BrN2O — CID 105367163
1-[(3-bromo-5-methyl-2-pyridinyl)amino]-3-methylbutan-2-ol (PubChem CID 105367163) has the molecular formula C11H17BrN2O and a molecular weight of 273.17 g/mol. Its IUPAC name is 1-[(3-bromo-5-methyl-2-pyridinyl)amino]-3-methylbutan-2-ol.
| Compound Name | 1-[(3-bromo-5-methyl-2-pyridinyl)amino]-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 105367163 |
| Molecular Formula | C11H17BrN2O |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-[(3-bromo-5-methyl-2-pyridinyl)amino]-3-methylbutan-2-ol |
| SMILES | Cc1cnc(NCC(O)C(C)C)c(Br)c1 |
| InChI | InChI=1S/C11H17BrN2O/c1-7(2)10(15)6-14-11-9(12)4-8(3)5-13-11/h4-5,7,10,15H,6H2,1-3H3,(H,13,14) |
| InChIKey | AENGNTMMDFGPQZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |