C13H21BrN4O — CID 103968689
[1-[[[5-bromo-2-(methylamino)pyrimidin-4-yl]amino]methyl]cyclohexyl]methanol (PubChem CID 103968689) has the molecular formula C13H21BrN4O and a molecular weight of 329.24 g/mol. Its IUPAC name is [1-[[[5-bromo-2-(methylamino)pyrimidin-4-yl]amino]methyl]cyclohexyl]methanol.
| Compound Name | [1-[[[5-bromo-2-(methylamino)pyrimidin-4-yl]amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 103968689 |
| Molecular Formula | C13H21BrN4O |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | [1-[[[5-bromo-2-(methylamino)pyrimidin-4-yl]amino]methyl]cyclohexyl]methanol |
| SMILES | CNc1ncc(Br)c(NCC2(CO)CCCCC2)n1 |
| InChI | InChI=1S/C13H21BrN4O/c1-15-12-16-7-10(14)11(18-12)17-8-13(9-19)5-3-2-4-6-13/h7,19H,2-6,8-9H2,1H3,(H2,15,16,17,18) |
| InChIKey | RMNIZQRKUUQUIK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |