C15H25BrN4O — CID 80828340
1-[[[5-bromo-2-(propylamino)pyrimidin-4-yl]amino]methyl]cycloheptan-1-ol (PubChem CID 80828340) has the molecular formula C15H25BrN4O and a molecular weight of 357.30 g/mol. Its IUPAC name is 1-[[[5-bromo-2-(propylamino)pyrimidin-4-yl]amino]methyl]cycloheptan-1-ol.
| Compound Name | 1-[[[5-bromo-2-(propylamino)pyrimidin-4-yl]amino]methyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 80828340 |
| Molecular Formula | C15H25BrN4O |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-[[[5-bromo-2-(propylamino)pyrimidin-4-yl]amino]methyl]cycloheptan-1-ol |
| SMILES | CCCNc1ncc(Br)c(NCC2(O)CCCCCC2)n1 |
| InChI | InChI=1S/C15H25BrN4O/c1-2-9-17-14-18-10-12(16)13(20-14)19-11-15(21)7-5-3-4-6-8-15/h10,21H,2-9,11H2,1H3,(H2,17,18,19,20) |
| InChIKey | OVWBOKSSELCNBB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |