C9H16BrN5S — CID 80912407
5-bromo-2-hydrazinyl-N-(2-methyl-3-methylsulfanylpropyl)pyrimidin-4-amine (PubChem CID 80912407) has the molecular formula C9H16BrN5S and a molecular weight of 306.23 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N-(2-methyl-3-methylsulfanylpropyl)pyrimidin-4-amine.
| Compound Name | 5-bromo-2-hydrazinyl-N-(2-methyl-3-methylsulfanylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80912407 |
| Molecular Formula | C9H16BrN5S |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N-(2-methyl-3-methylsulfanylpropyl)pyrimidin-4-amine |
| SMILES | CSCC(C)CNc1nc(NN)ncc1Br |
| InChI | InChI=1S/C9H16BrN5S/c1-6(5-16-2)3-12-8-7(10)4-13-9(14-8)15-11/h4,6H,3,5,11H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | WGVBDXSRDTYSOP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|