C10H19N5S — CID 80913030
6-hydrazinyl-5-methyl-N-(2-methyl-3-methylsulfanylpropyl)pyrimidin-4-amine (PubChem CID 80913030) has the molecular formula C10H19N5S and a molecular weight of 241.36 g/mol. Its IUPAC name is 6-hydrazinyl-5-methyl-N-(2-methyl-3-methylsulfanylpropyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-5-methyl-N-(2-methyl-3-methylsulfanylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80913030 |
| Molecular Formula | C10H19N5S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 6-hydrazinyl-5-methyl-N-(2-methyl-3-methylsulfanylpropyl)pyrimidin-4-amine |
| SMILES | CSCC(C)CNc1ncnc(NN)c1C |
| InChI | InChI=1S/C10H19N5S/c1-7(5-16-3)4-12-9-8(2)10(15-11)14-6-13-9/h6-7H,4-5,11H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | GRMATBQMYDAKRC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|