C8H12BrN5O2 — CID 80899107
methyl 3-[(5-bromo-2-hydrazinylpyrimidin-4-yl)amino]propanoate (PubChem CID 80899107) has the molecular formula C8H12BrN5O2 and a molecular weight of 290.12 g/mol. Its IUPAC name is methyl 3-[(5-bromo-2-hydrazinylpyrimidin-4-yl)amino]propanoate.
| Compound Name | methyl 3-[(5-bromo-2-hydrazinylpyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 80899107 |
| Molecular Formula | C8H12BrN5O2 |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | methyl 3-[(5-bromo-2-hydrazinylpyrimidin-4-yl)amino]propanoate |
| SMILES | COC(=O)CCNc1nc(NN)ncc1Br |
| InChI | InChI=1S/C8H12BrN5O2/c1-16-6(15)2-3-11-7-5(9)4-12-8(13-7)14-10/h4H,2-3,10H2,1H3,(H2,11,12,13,14) |
| InChIKey | MQUYZSJLBOMPDV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|