C9H17BrN6 — CID 80918989
N-(5-bromo-2-hydrazinylpyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine (PubChem CID 80918989) has the molecular formula C9H17BrN6 and a molecular weight of 289.18 g/mol. Its IUPAC name is N-(5-bromo-2-hydrazinylpyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine.
| Compound Name | N-(5-bromo-2-hydrazinylpyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 80918989 |
| Molecular Formula | C9H17BrN6 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | N-(5-bromo-2-hydrazinylpyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine |
| SMILES | CCN(C)CCNc1nc(NN)ncc1Br |
| InChI | InChI=1S/C9H17BrN6/c1-3-16(2)5-4-12-8-7(10)6-13-9(14-8)15-11/h6H,3-5,11H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | UFKKXFKQDCHJNJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|