C12H12BrF2N5 — CID 80918985
5-bromo-N-[2-(3,5-difluorophenyl)ethyl]-2-hydrazinylpyrimidin-4-amine (PubChem CID 80918985) has the molecular formula C12H12BrF2N5 and a molecular weight of 344.16 g/mol. Its IUPAC name is 5-bromo-N-[2-(3,5-difluorophenyl)ethyl]-2-hydrazinylpyrimidin-4-amine.
| Compound Name | 5-bromo-N-[2-(3,5-difluorophenyl)ethyl]-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80918985 |
| Molecular Formula | C12H12BrF2N5 |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 5-bromo-N-[2-(3,5-difluorophenyl)ethyl]-2-hydrazinylpyrimidin-4-amine |
| SMILES | NNc1ncc(Br)c(NCCc2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C12H12BrF2N5/c13-10-6-18-12(20-16)19-11(10)17-2-1-7-3-8(14)5-9(15)4-7/h3-6H,1-2,16H2,(H2,17,18,19,20) |
| InChIKey | CMAPBOZFYCOCDY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|