C12H12F3N5 — CID 80919063
N-[2-(3,5-difluorophenyl)ethyl]-5-fluoro-2-hydrazinylpyrimidin-4-amine (PubChem CID 80919063) has the molecular formula C12H12F3N5 and a molecular weight of 283.26 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]-5-fluoro-2-hydrazinylpyrimidin-4-amine.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]-5-fluoro-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80919063 |
| Molecular Formula | C12H12F3N5 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]-5-fluoro-2-hydrazinylpyrimidin-4-amine |
| SMILES | NNc1ncc(F)c(NCCc2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C12H12F3N5/c13-8-3-7(4-9(14)5-8)1-2-17-11-10(15)6-18-12(19-11)20-16/h3-6H,1-2,16H2,(H2,17,18,19,20) |
| InChIKey | BQXVGRJKBGMNMO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|