C11H20FN5O — CID 106012916
5-fluoro-2-hydrazinyl-N-(4-propan-2-yloxybutyl)pyrimidin-4-amine (PubChem CID 106012916) has the molecular formula C11H20FN5O and a molecular weight of 257.31 g/mol. Its IUPAC name is 5-fluoro-2-hydrazinyl-N-(4-propan-2-yloxybutyl)pyrimidin-4-amine.
| Compound Name | 5-fluoro-2-hydrazinyl-N-(4-propan-2-yloxybutyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106012916 |
| Molecular Formula | C11H20FN5O |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 5-fluoro-2-hydrazinyl-N-(4-propan-2-yloxybutyl)pyrimidin-4-amine |
| SMILES | CC(C)OCCCCNc1nc(NN)ncc1F |
| InChI | InChI=1S/C11H20FN5O/c1-8(2)18-6-4-3-5-14-10-9(12)7-15-11(16-10)17-13/h7-8H,3-6,13H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | XINHUKWRUJFXBN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|