C15H24N6 — CID 80938208
N',N'-diethyl-N-(2-hydrazinylquinazolin-4-yl)propane-1,3-diamine (PubChem CID 80938208) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is N',N'-diethyl-N-(2-hydrazinylquinazolin-4-yl)propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-(2-hydrazinylquinazolin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 80938208 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | N',N'-diethyl-N-(2-hydrazinylquinazolin-4-yl)propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(NN)nc2ccccc12 |
| InChI | InChI=1S/C15H24N6/c1-3-21(4-2)11-7-10-17-14-12-8-5-6-9-13(12)18-15(19-14)20-16/h5-6,8-9H,3-4,7,10-11,16H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | SJRPVKMUDTWVSN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|