C23H27FN4 — CID 121453105
N',N'-diethyl-N-[2-[(E)-2-(4-fluorophenyl)ethenyl]quinazolin-4-yl]propane-1,3-diamine (PubChem CID 121453105) has the molecular formula C23H27FN4 and a molecular weight of 378.50 g/mol. Its IUPAC name is N',N'-diethyl-N-[2-[(E)-2-(4-fluorophenyl)ethenyl]quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[2-[(E)-2-(4-fluorophenyl)ethenyl]quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 121453105 |
| Molecular Formula | C23H27FN4 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | N',N'-diethyl-N-[2-[(E)-2-(4-fluorophenyl)ethenyl]quinazolin-4-yl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(/C=C/c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H27FN4/c1-3-28(4-2)17-7-16-25-23-20-8-5-6-9-21(20)26-22(27-23)15-12-18-10-13-19(24)14-11-18/h5-6,8-15H,3-4,7,16-17H2,1-2H3,(H,25,26,27)/b15-12+ |
| InChIKey | LMXNGXSDZKZEAQ-NTCAYCPXSA-N |
| XLogP | 5.08 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|