C30H43FN4 — CID 144787653
N-[2-[(E)-2-(4-ethylphenyl)ethenyl]-6-fluoroquinazolin-4-yl]-N',N'-dipropylpropane-1,3-diamine;propane (PubChem CID 144787653) has the molecular formula C30H43FN4 and a molecular weight of 478.70 g/mol. Its IUPAC name is N-[2-[(E)-2-(4-ethylphenyl)ethenyl]-6-fluoroquinazolin-4-yl]-N',N'-dipropylpropane-1,3-diamine;propane.
| Compound Name | N-[2-[(E)-2-(4-ethylphenyl)ethenyl]-6-fluoroquinazolin-4-yl]-N',N'-dipropylpropane-1,3-diamine;propane |
|---|---|
| PubChem CID | 144787653 |
| Molecular Formula | C30H43FN4 |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | N-[2-[(E)-2-(4-ethylphenyl)ethenyl]-6-fluoroquinazolin-4-yl]-N',N'-dipropylpropane-1,3-diamine;propane |
| SMILES | CCC.CCCN(CCC)CCCNc1nc(/C=C/c2ccc(CC)cc2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C27H35FN4.C3H8/c1-4-17-32(18-5-2)19-7-16-29-27-24-20-23(28)13-14-25(24)30-26(31-27)15-12-22-10-8-21(6-3)9-11-22;1-3-2/h8-15,20H,4-7,16-19H2,1-3H3,(H,29,30,31);3H2,1-2H3/b15-12+; |
| InChIKey | LHCSRCGOZCLZSM-JRUHLWALSA-N |
| XLogP | 7.84 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|