C23H25N3O — CID 159004026
5-[[6-methyl-2-[(E)-2-(4-methylphenyl)ethenyl]quinazolin-4-yl]amino]pentan-2-one (PubChem CID 159004026) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 5-[[6-methyl-2-[(E)-2-(4-methylphenyl)ethenyl]quinazolin-4-yl]amino]pentan-2-one.
| Compound Name | 5-[[6-methyl-2-[(E)-2-(4-methylphenyl)ethenyl]quinazolin-4-yl]amino]pentan-2-one |
|---|---|
| PubChem CID | 159004026 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 5-[[6-methyl-2-[(E)-2-(4-methylphenyl)ethenyl]quinazolin-4-yl]amino]pentan-2-one |
| SMILES | CC(=O)CCCNc1nc(/C=C/c2ccc(C)cc2)nc2ccc(C)cc12 |
| InChI | InChI=1S/C23H25N3O/c1-16-6-9-19(10-7-16)11-13-22-25-21-12-8-17(2)15-20(21)23(26-22)24-14-4-5-18(3)27/h6-13,15H,4-5,14H2,1-3H3,(H,24,25,26)/b13-11+ |
| InChIKey | DCHPJKHIRVUNGA-ACCUITESSA-N |
| XLogP | 5.20 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|