C18H28N4 — CID 159347736
methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine (PubChem CID 159347736) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine.
| Compound Name | methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 159347736 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine |
| SMILES | C.C=CCNc1nc(NCCCCC)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C17H24N4.CH4/c1-4-6-7-11-18-16-14-12-13(3)8-9-15(14)20-17(21-16)19-10-5-2;/h5,8-9,12H,2,4,6-7,10-11H2,1,3H3,(H2,18,19,20,21);1H4 |
| InChIKey | LGYBVIKUHQBINO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|