About methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine
methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine (PubChem CID 159347736) has the molecular formula C18H28N4
and a molecular weight of 300.45 g/mol. Its IUPAC name is methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine.
Molecular Properties
| Compound Name | methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine |
| PubChem CID | 159347736 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine |
| SMILES | C.C=CCNc1nc(NCCCCC)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C17H24N4.CH4/c1-4-6-7-11-18-16-14-12-13(3)8-9-15(14)20-17(21-16)19-10-5-2;/h5,8-9,12H,2,4,6-7,10-11H2,1,3H3,(H2,18,19,20,21);1H4 |
| InChIKey | LGYBVIKUHQBINO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine?
The IUPAC name of methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine (CID 159347736) is methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine.
What is the SMILES notation for methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine?
The canonical SMILES for methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine is C.C=CCNc1nc(NCCCCC)c2cc(C)ccc2n1.
What is the InChIKey of methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine?
The InChIKey is LGYBVIKUHQBINO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4.CH4/c1-4-6-7-11-18-16-14-12-13(3)8-9-15(14)20-17(21-16)19-10-5-2;/h5,8-9,12H,2,4,6-7,10-11H2,1,3H3,(H2,18,19,20,21);1H4.
What are the key properties of methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine?
methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine has a molecular weight of 300.45 g/mol, XLogP of 4.77, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;6-methyl-4-N-pentyl-2-N-prop-2-enylquinazoline-2,4-diamine is sourced from PubChem (CID 159347736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).