C17H18N4 — CID 138683087
4-N-benzyl-2-N,6-dimethylquinazoline-2,4-diamine (PubChem CID 138683087) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-N-benzyl-2-N,6-dimethylquinazoline-2,4-diamine.
| Compound Name | 4-N-benzyl-2-N,6-dimethylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 138683087 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 4-N-benzyl-2-N,6-dimethylquinazoline-2,4-diamine |
| SMILES | CNc1nc(NCc2ccccc2)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C17H18N4/c1-12-8-9-15-14(10-12)16(21-17(18-2)20-15)19-11-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | JUXOPDVVMIFRQP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |