C24H23N5 — CID 69239625
N-[[4-(aminomethyl)phenyl]methyl]-6-methyl-2-[(E)-2-pyridin-2-ylethenyl]quinazolin-4-amine (PubChem CID 69239625) has the molecular formula C24H23N5 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-[[4-(aminomethyl)phenyl]methyl]-6-methyl-2-[(E)-2-pyridin-2-ylethenyl]quinazolin-4-amine.
| Compound Name | N-[[4-(aminomethyl)phenyl]methyl]-6-methyl-2-[(E)-2-pyridin-2-ylethenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 69239625 |
| Molecular Formula | C24H23N5 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | N-[[4-(aminomethyl)phenyl]methyl]-6-methyl-2-[(E)-2-pyridin-2-ylethenyl]quinazolin-4-amine |
| SMILES | Cc1ccc2nc(/C=C/c3ccccn3)nc(NCc3ccc(CN)cc3)c2c1 |
| InChI | InChI=1S/C24H23N5/c1-17-5-11-22-21(14-17)24(27-16-19-8-6-18(15-25)7-9-19)29-23(28-22)12-10-20-4-2-3-13-26-20/h2-14H,15-16,25H2,1H3,(H,27,28,29)/b12-10+ |
| InChIKey | XRABJGKBPAZZSZ-ZRDIBKRKSA-N |
| XLogP | 4.57 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |