C30H34N6OS — CID 69086474
methyl N'-[6-[[6-methoxy-2-(2-pyridin-2-ylethenyl)quinazolin-4-yl]amino]hexyl]-N-phenylcarbamimidothioate (PubChem CID 69086474) has the molecular formula C30H34N6OS and a molecular weight of 526.71 g/mol. Its IUPAC name is methyl N'-[6-[[6-methoxy-2-(2-pyridin-2-ylethenyl)quinazolin-4-yl]amino]hexyl]-N-phenylcarbamimidothioate.
| Compound Name | methyl N'-[6-[[6-methoxy-2-(2-pyridin-2-ylethenyl)quinazolin-4-yl]amino]hexyl]-N-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 69086474 |
| Molecular Formula | C30H34N6OS |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | methyl N'-[6-[[6-methoxy-2-(2-pyridin-2-ylethenyl)quinazolin-4-yl]amino]hexyl]-N-phenylcarbamimidothioate |
| SMILES | COc1ccc2nc(C=Cc3ccccn3)nc(NCCCCCC/N=C(/Nc3ccccc3)SC)c2c1 |
| InChI | InChI=1S/C30H34N6OS/c1-37-25-16-17-27-26(22-25)29(36-28(35-27)18-15-23-12-8-11-19-31-23)32-20-9-3-4-10-21-33-30(38-2)34-24-13-6-5-7-14-24/h5-8,11-19,22H,3-4,9-10,20-21H2,1-2H3,(H,33,34)(H,32,35,36) |
| InChIKey | BDQDIEJIFNRCKB-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|