C23H27N7O — CID 161017587
1-amino-1-[(1S,2R)-2-[6-methoxy-2-[(Z)-2-pyridin-2-ylethenyl]quinazolin-4-yl]cyclohexyl]guanidine (PubChem CID 161017587) has the molecular formula C23H27N7O and a molecular weight of 417.52 g/mol. Its IUPAC name is 1-amino-1-[(1S,2R)-2-[6-methoxy-2-[(Z)-2-pyridin-2-ylethenyl]quinazolin-4-yl]cyclohexyl]guanidine.
| Compound Name | 1-amino-1-[(1S,2R)-2-[6-methoxy-2-[(Z)-2-pyridin-2-ylethenyl]quinazolin-4-yl]cyclohexyl]guanidine |
|---|---|
| PubChem CID | 161017587 |
| Molecular Formula | C23H27N7O |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 1-amino-1-[(1S,2R)-2-[6-methoxy-2-[(Z)-2-pyridin-2-ylethenyl]quinazolin-4-yl]cyclohexyl]guanidine |
| SMILES | [H]/N=C(\N)N(N)[C@H]1CCCC[C@H]1c1nc(/C=C\c2ccccn2)nc2ccc(OC)cc12 |
| InChI | InChI=1S/C23H27N7O/c1-31-16-10-11-19-18(14-16)22(17-7-2-3-8-20(17)30(26)23(24)25)29-21(28-19)12-9-15-6-4-5-13-27-15/h4-6,9-14,17,20H,2-3,7-8,26H2,1H3,(H3,24,25)/b12-9-/t17-,20+/m1/s1 |
| InChIKey | TXXUILQGPBPLGQ-IXRWAAFTSA-N |
| XLogP | 3.30 |
| TPSA | 127.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|