C23H25ClN4O — CID 69150682
[(1R,2S)-2-[2-[2-(4-chlorophenyl)ethenyl]-6-methoxyquinazolin-4-yl]cyclohexyl]hydrazine (PubChem CID 69150682) has the molecular formula C23H25ClN4O and a molecular weight of 408.93 g/mol. Its IUPAC name is [(1R,2S)-2-[2-[2-(4-chlorophenyl)ethenyl]-6-methoxyquinazolin-4-yl]cyclohexyl]hydrazine.
| Compound Name | [(1R,2S)-2-[2-[2-(4-chlorophenyl)ethenyl]-6-methoxyquinazolin-4-yl]cyclohexyl]hydrazine |
|---|---|
| PubChem CID | 69150682 |
| Molecular Formula | C23H25ClN4O |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [(1R,2S)-2-[2-[2-(4-chlorophenyl)ethenyl]-6-methoxyquinazolin-4-yl]cyclohexyl]hydrazine |
| SMILES | COc1ccc2nc(C=Cc3ccc(Cl)cc3)nc([C@H]3CCCC[C@H]3NN)c2c1 |
| InChI | InChI=1S/C23H25ClN4O/c1-29-17-11-12-20-19(14-17)23(18-4-2-3-5-21(18)28-25)27-22(26-20)13-8-15-6-9-16(24)10-7-15/h6-14,18,21,28H,2-5,25H2,1H3/t18-,21+/m0/s1 |
| InChIKey | GWNRMVSBCOPRLG-GHTZIAJQSA-N |
| XLogP | 4.95 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|