C24H29Cl3N6O — CID 69021637
2-[(1S,2R)-2-[[2-[(Z)-2-(4-chlorophenyl)ethenyl]-6-methoxyquinazolin-4-yl]amino]cyclohexyl]guanidine;dihydrochloride (PubChem CID 69021637) has the molecular formula C24H29Cl3N6O and a molecular weight of 523.90 g/mol. Its IUPAC name is 2-[(1S,2R)-2-[[2-[(Z)-2-(4-chlorophenyl)ethenyl]-6-methoxyquinazolin-4-yl]amino]cyclohexyl]guanidine;dihydrochloride.
| Compound Name | 2-[(1S,2R)-2-[[2-[(Z)-2-(4-chlorophenyl)ethenyl]-6-methoxyquinazolin-4-yl]amino]cyclohexyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 69021637 |
| Molecular Formula | C24H29Cl3N6O |
| Molecular Weight | 523.90 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 2-[(1S,2R)-2-[[2-[(Z)-2-(4-chlorophenyl)ethenyl]-6-methoxyquinazolin-4-yl]amino]cyclohexyl]guanidine;dihydrochloride |
| SMILES | COc1ccc2nc(/C=C\c3ccc(Cl)cc3)nc(N[C@@H]3CCCC[C@@H]3N=C(N)N)c2c1.Cl.Cl |
| InChI | InChI=1S/C24H27ClN6O.2ClH/c1-32-17-11-12-19-18(14-17)23(29-20-4-2-3-5-21(20)30-24(26)27)31-22(28-19)13-8-15-6-9-16(25)10-7-15;;/h6-14,20-21H,2-5H2,1H3,(H4,26,27,30)(H,28,29,31);2*1H/b13-8-;;/t20-,21+;;/m1../s1 |
| InChIKey | RVNUEBBCFRLWHL-KZJIUNCISA-N |
| XLogP | 5.30 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.90 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|