C23H25ClN6O — CID 69021916
2-[(1R,2S)-2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-methoxyquinazolin-4-yl]amino]cyclopentyl]guanidine (PubChem CID 69021916) has the molecular formula C23H25ClN6O and a molecular weight of 436.95 g/mol. Its IUPAC name is 2-[(1R,2S)-2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-methoxyquinazolin-4-yl]amino]cyclopentyl]guanidine.
| Compound Name | 2-[(1R,2S)-2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-methoxyquinazolin-4-yl]amino]cyclopentyl]guanidine |
|---|---|
| PubChem CID | 69021916 |
| Molecular Formula | C23H25ClN6O |
| Molecular Weight | 436.95 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-[(1R,2S)-2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-methoxyquinazolin-4-yl]amino]cyclopentyl]guanidine |
| SMILES | COc1ccc2nc(/C=C/c3ccc(Cl)cc3)nc(N[C@H]3CCC[C@H]3N=C(N)N)c2c1 |
| InChI | InChI=1S/C23H25ClN6O/c1-31-16-10-11-18-17(13-16)22(28-19-3-2-4-20(19)29-23(25)26)30-21(27-18)12-7-14-5-8-15(24)9-6-14/h5-13,19-20H,2-4H2,1H3,(H4,25,26,29)(H,27,28,30)/b12-7+/t19-,20+/m0/s1 |
| InChIKey | JPIMLLUHIHFWLA-PIRCGCSWSA-N |
| XLogP | 4.07 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.95 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|