C25H28ClN5O — CID 22667940
2-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-methoxyquinolin-4-yl]amino]cyclohexyl]guanidine (PubChem CID 22667940) has the molecular formula C25H28ClN5O and a molecular weight of 449.99 g/mol. Its IUPAC name is 2-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-methoxyquinolin-4-yl]amino]cyclohexyl]guanidine.
| Compound Name | 2-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-methoxyquinolin-4-yl]amino]cyclohexyl]guanidine |
|---|---|
| PubChem CID | 22667940 |
| Molecular Formula | C25H28ClN5O |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-methoxyquinolin-4-yl]amino]cyclohexyl]guanidine |
| SMILES | COc1ccc2nc(/C=C/c3ccc(Cl)cc3)cc(NC3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C25H28ClN5O/c1-32-19-12-13-21-20(15-19)24(30-22-4-2-3-5-23(22)31-25(27)28)14-18(29-21)11-8-16-6-9-17(26)10-7-16/h6-15,22-23H,2-5H2,1H3,(H,29,30)(H4,27,28,31)/b11-8+ |
| InChIKey | JOUBREVYOKLWCN-DHZHZOJOSA-N |
| XLogP | 5.06 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|