C23H27Cl3N6O — CID 22668004
2-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-hydroxyquinazolin-4-yl]amino]cyclohexyl]guanidine;dihydrochloride (PubChem CID 22668004) has the molecular formula C23H27Cl3N6O and a molecular weight of 509.87 g/mol. Its IUPAC name is 2-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-hydroxyquinazolin-4-yl]amino]cyclohexyl]guanidine;dihydrochloride.
| Compound Name | 2-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-hydroxyquinazolin-4-yl]amino]cyclohexyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 22668004 |
| Molecular Formula | C23H27Cl3N6O |
| Molecular Weight | 509.87 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 2-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-hydroxyquinazolin-4-yl]amino]cyclohexyl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=NC1CCCCC1Nc1nc(/C=C/c2ccc(Cl)cc2)nc2ccc(O)cc12 |
| InChI | InChI=1S/C23H25ClN6O.2ClH/c24-15-8-5-14(6-9-15)7-12-21-27-18-11-10-16(31)13-17(18)22(30-21)28-19-3-1-2-4-20(19)29-23(25)26;;/h5-13,19-20,31H,1-4H2,(H4,25,26,29)(H,27,28,30);2*1H/b12-7+;; |
| InChIKey | SQAZZXKDFCRNSM-CURPJKDSSA-N |
| XLogP | 5.00 |
| TPSA | 122.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.87 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|