C25H29ClN6O — CID 22667926
2-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-ethoxyquinazolin-4-yl]amino]cyclohexyl]guanidine (PubChem CID 22667926) has the molecular formula C25H29ClN6O and a molecular weight of 465.00 g/mol. Its IUPAC name is 2-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-ethoxyquinazolin-4-yl]amino]cyclohexyl]guanidine.
| Compound Name | 2-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-ethoxyquinazolin-4-yl]amino]cyclohexyl]guanidine |
|---|---|
| PubChem CID | 22667926 |
| Molecular Formula | C25H29ClN6O |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 2-[2-[[2-[(E)-2-(4-chlorophenyl)ethenyl]-6-ethoxyquinazolin-4-yl]amino]cyclohexyl]guanidine |
| SMILES | CCOc1ccc2nc(/C=C/c3ccc(Cl)cc3)nc(NC3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C25H29ClN6O/c1-2-33-18-12-13-20-19(15-18)24(30-21-5-3-4-6-22(21)31-25(27)28)32-23(29-20)14-9-16-7-10-17(26)11-8-16/h7-15,21-22H,2-6H2,1H3,(H4,27,28,31)(H,29,30,32)/b14-9+ |
| InChIKey | KULKMDUUVWTQAQ-NTEUORMPSA-N |
| XLogP | 4.85 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|