C25H28ClN5 — CID 69023779
2-[(1R,2S)-2-[[2-[2-(4-chlorophenyl)ethenyl]-6-methylquinolin-4-yl]amino]cyclohexyl]guanidine (PubChem CID 69023779) has the molecular formula C25H28ClN5 and a molecular weight of 433.99 g/mol. Its IUPAC name is 2-[(1R,2S)-2-[[2-[2-(4-chlorophenyl)ethenyl]-6-methylquinolin-4-yl]amino]cyclohexyl]guanidine.
| Compound Name | 2-[(1R,2S)-2-[[2-[2-(4-chlorophenyl)ethenyl]-6-methylquinolin-4-yl]amino]cyclohexyl]guanidine |
|---|---|
| PubChem CID | 69023779 |
| Molecular Formula | C25H28ClN5 |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-[(1R,2S)-2-[[2-[2-(4-chlorophenyl)ethenyl]-6-methylquinolin-4-yl]amino]cyclohexyl]guanidine |
| SMILES | Cc1ccc2nc(C=Cc3ccc(Cl)cc3)cc(N[C@H]3CCCC[C@H]3N=C(N)N)c2c1 |
| InChI | InChI=1S/C25H28ClN5/c1-16-6-13-21-20(14-16)24(30-22-4-2-3-5-23(22)31-25(27)28)15-19(29-21)12-9-17-7-10-18(26)11-8-17/h6-15,22-23H,2-5H2,1H3,(H,29,30)(H4,27,28,31)/t22-,23+/m0/s1 |
| InChIKey | UYAJXGTZVIOZQO-XZOQPEGZSA-N |
| XLogP | 5.36 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|