C23H25Cl2N7O — CID 87506211
2,4-dichloro-N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]benzamide (PubChem CID 87506211) has the molecular formula C23H25Cl2N7O and a molecular weight of 486.41 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]benzamide |
|---|---|
| PubChem CID | 87506211 |
| Molecular Formula | C23H25Cl2N7O |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 2,4-dichloro-N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]benzamide |
| SMILES | Cc1ccc2nc(NC(=O)c3ccc(Cl)cc3Cl)nc(NC3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C23H25Cl2N7O/c1-12-6-9-17-15(10-12)20(28-18-4-2-3-5-19(18)29-22(26)27)31-23(30-17)32-21(33)14-8-7-13(24)11-16(14)25/h6-11,18-19H,2-5H2,1H3,(H4,26,27,29)(H2,28,30,31,32,33) |
| InChIKey | HPEHLJKYXCUJPT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|