C25H34Cl2N8O — CID 68582880
N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-2-(dimethylamino)benzamide;dihydrochloride (PubChem CID 68582880) has the molecular formula C25H34Cl2N8O and a molecular weight of 533.51 g/mol. Its IUPAC name is N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-2-(dimethylamino)benzamide;dihydrochloride.
| Compound Name | N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-2-(dimethylamino)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 68582880 |
| Molecular Formula | C25H34Cl2N8O |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-2-(dimethylamino)benzamide;dihydrochloride |
| SMILES | Cc1ccc2nc(NC(=O)c3ccccc3N(C)C)nc(N[C@H]3CCCC[C@H]3N=C(N)N)c2c1.Cl.Cl |
| InChI | InChI=1S/C25H32N8O.2ClH/c1-15-12-13-18-17(14-15)22(28-19-9-5-6-10-20(19)29-24(26)27)31-25(30-18)32-23(34)16-8-4-7-11-21(16)33(2)3;;/h4,7-8,11-14,19-20H,5-6,9-10H2,1-3H3,(H4,26,27,29)(H2,28,30,31,32,34);2*1H/t19-,20+;;/m0../s1 |
| InChIKey | LASVLDOYEGSOCR-HUQPAIQZSA-N |
| XLogP | 4.10 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|