C21H31Cl2N7O — CID 68582072
N-(cyclopropylmethyl)-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;dihydrochloride (PubChem CID 68582072) has the molecular formula C21H31Cl2N7O and a molecular weight of 468.43 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;dihydrochloride.
| Compound Name | N-(cyclopropylmethyl)-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 68582072 |
| Molecular Formula | C21H31Cl2N7O |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-(cyclopropylmethyl)-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;dihydrochloride |
| SMILES | Cc1ccc2nc(C(=O)NCC3CC3)nc(N[C@H]3CCCC[C@H]3N=C(N)N)c2c1.Cl.Cl |
| InChI | InChI=1S/C21H29N7O.2ClH/c1-12-6-9-15-14(10-12)18(26-16-4-2-3-5-17(16)27-21(22)23)28-19(25-15)20(29)24-11-13-7-8-13;;/h6,9-10,13,16-17H,2-5,7-8,11H2,1H3,(H,24,29)(H4,22,23,27)(H,25,26,28);2*1H/t16-,17+;;/m0../s1 |
| InChIKey | DKLIVLPVZMYLBN-UXHRTOHASA-N |
| XLogP | 2.92 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|