C25H33Cl2N7O2 — CID 68582194
4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-[(4-methoxyphenyl)methyl]-6-methylquinazoline-2-carboxamide;dihydrochloride (PubChem CID 68582194) has the molecular formula C25H33Cl2N7O2 and a molecular weight of 534.49 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-[(4-methoxyphenyl)methyl]-6-methylquinazoline-2-carboxamide;dihydrochloride.
| Compound Name | 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-[(4-methoxyphenyl)methyl]-6-methylquinazoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 68582194 |
| Molecular Formula | C25H33Cl2N7O2 |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-N-[(4-methoxyphenyl)methyl]-6-methylquinazoline-2-carboxamide;dihydrochloride |
| SMILES | COc1ccc(CNC(=O)c2nc(N[C@H]3CCCC[C@H]3N=C(N)N)c3cc(C)ccc3n2)cc1.Cl.Cl |
| InChI | InChI=1S/C25H31N7O2.2ClH/c1-15-7-12-19-18(13-15)22(30-20-5-3-4-6-21(20)31-25(26)27)32-23(29-19)24(33)28-14-16-8-10-17(34-2)11-9-16;;/h7-13,20-21H,3-6,14H2,1-2H3,(H,28,33)(H4,26,27,31)(H,29,30,32);2*1H/t20-,21+;;/m0../s1 |
| InChIKey | BUASVRIOAQMJNW-DDZPGPNZSA-N |
| XLogP | 3.72 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|