C24H28Cl2F3N7O2 — CID 68584415
4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-[4-(trifluoromethoxy)phenyl]quinazoline-2-carboxamide;dihydrochloride (PubChem CID 68584415) has the molecular formula C24H28Cl2F3N7O2 and a molecular weight of 574.44 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-[4-(trifluoromethoxy)phenyl]quinazoline-2-carboxamide;dihydrochloride.
| Compound Name | 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-[4-(trifluoromethoxy)phenyl]quinazoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 68584415 |
| Molecular Formula | C24H28Cl2F3N7O2 |
| Molecular Weight | 574.44 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-[4-(trifluoromethoxy)phenyl]quinazoline-2-carboxamide;dihydrochloride |
| SMILES | Cc1ccc2nc(C(=O)Nc3ccc(OC(F)(F)F)cc3)nc(N[C@H]3CCCC[C@H]3N=C(N)N)c2c1.Cl.Cl |
| InChI | InChI=1S/C24H26F3N7O2.2ClH/c1-13-6-11-17-16(12-13)20(32-18-4-2-3-5-19(18)33-23(28)29)34-21(31-17)22(35)30-14-7-9-15(10-8-14)36-24(25,26)27;;/h6-12,18-19H,2-5H2,1H3,(H,30,35)(H4,28,29,33)(H,31,32,34);2*1H/t18-,19+;;/m0../s1 |
| InChIKey | UBBFKWPCXNEZOO-DPSPSOFVSA-N |
| XLogP | 4.93 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|