C24H35N7O — CID 87505966
4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(4-methylcyclohexyl)quinazoline-2-carboxamide (PubChem CID 87505966) has the molecular formula C24H35N7O and a molecular weight of 437.59 g/mol. Its IUPAC name is 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(4-methylcyclohexyl)quinazoline-2-carboxamide.
| Compound Name | 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(4-methylcyclohexyl)quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 87505966 |
| Molecular Formula | C24H35N7O |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(4-methylcyclohexyl)quinazoline-2-carboxamide |
| SMILES | Cc1ccc2nc(C(=O)NC3CCC(C)CC3)nc(NC3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C24H35N7O/c1-14-7-10-16(11-8-14)27-23(32)22-28-18-12-9-15(2)13-17(18)21(31-22)29-19-5-3-4-6-20(19)30-24(25)26/h9,12-14,16,19-20H,3-8,10-11H2,1-2H3,(H,27,32)(H4,25,26,30)(H,28,29,31) |
| InChIKey | AUQGPEHWAQXBNK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|