C26H39N7O — CID 87504900
4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(3,3,5-trimethylcyclohexyl)quinazoline-2-carboxamide (PubChem CID 87504900) has the molecular formula C26H39N7O and a molecular weight of 465.65 g/mol. Its IUPAC name is 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(3,3,5-trimethylcyclohexyl)quinazoline-2-carboxamide.
| Compound Name | 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(3,3,5-trimethylcyclohexyl)quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 87504900 |
| Molecular Formula | C26H39N7O |
| Molecular Weight | 465.65 g/mol |
| Exact Mass | 465.32 |
| IUPAC Name | 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(3,3,5-trimethylcyclohexyl)quinazoline-2-carboxamide |
| SMILES | Cc1ccc2nc(C(=O)NC3CC(C)CC(C)(C)C3)nc(NC3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C26H39N7O/c1-15-9-10-19-18(12-15)22(31-20-7-5-6-8-21(20)32-25(27)28)33-23(30-19)24(34)29-17-11-16(2)13-26(3,4)14-17/h9-10,12,16-17,20-21H,5-8,11,13-14H2,1-4H3,(H,29,34)(H4,27,28,32)(H,30,31,33) |
| InChIKey | UTERAVRHRSVAGE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.65 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|