C25H31N7O — CID 87506104
4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-[(1R)-1-phenylethyl]quinazoline-2-carboxamide (PubChem CID 87506104) has the molecular formula C25H31N7O and a molecular weight of 445.57 g/mol. Its IUPAC name is 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-[(1R)-1-phenylethyl]quinazoline-2-carboxamide.
| Compound Name | 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-[(1R)-1-phenylethyl]quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 87506104 |
| Molecular Formula | C25H31N7O |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-[(1R)-1-phenylethyl]quinazoline-2-carboxamide |
| SMILES | Cc1ccc2nc(C(=O)N[C@H](C)c3ccccc3)nc(NC3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C25H31N7O/c1-15-12-13-19-18(14-15)22(30-20-10-6-7-11-21(20)31-25(26)27)32-23(29-19)24(33)28-16(2)17-8-4-3-5-9-17/h3-5,8-9,12-14,16,20-21H,6-7,10-11H2,1-2H3,(H,28,33)(H4,26,27,31)(H,29,30,32)/t16-,20?,21?/m1/s1 |
| InChIKey | OATIIKWVAPUVLG-YMTQGWHGSA-N |
| XLogP | 3.43 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|