C25H29N7O3 — CID 142670582
(2R)-2-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]-2-phenylacetic acid (PubChem CID 142670582) has the molecular formula C25H29N7O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is (2R)-2-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 142670582 |
| Molecular Formula | C25H29N7O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | (2R)-2-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]-2-phenylacetic acid |
| SMILES | Cc1ccc2nc(C(=O)N[C@@H](C(=O)O)c3ccccc3)nc(NC3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C25H29N7O3/c1-14-11-12-17-16(13-14)21(29-18-9-5-6-10-19(18)30-25(26)27)32-22(28-17)23(33)31-20(24(34)35)15-7-3-2-4-8-15/h2-4,7-8,11-13,18-20H,5-6,9-10H2,1H3,(H,31,33)(H,34,35)(H4,26,27,30)(H,28,29,32)/t18?,19?,20-/m1/s1 |
| InChIKey | LMZVBQLFQNKUKI-SOAGJPPSSA-N |
| XLogP | 2.49 |
| TPSA | 168.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|