C23H28BrCl2N7O — CID 68581739
N-(4-bromophenyl)-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;dihydrochloride (PubChem CID 68581739) has the molecular formula C23H28BrCl2N7O and a molecular weight of 569.34 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;dihydrochloride.
| Compound Name | N-(4-bromophenyl)-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 68581739 |
| Molecular Formula | C23H28BrCl2N7O |
| Molecular Weight | 569.34 g/mol |
| Exact Mass | 567.09 |
| IUPAC Name | N-(4-bromophenyl)-4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;dihydrochloride |
| SMILES | Cc1ccc2nc(C(=O)Nc3ccc(Br)cc3)nc(N[C@H]3CCCCC3N=C(N)N)c2c1.Cl.Cl |
| InChI | InChI=1S/C23H26BrN7O.2ClH/c1-13-6-11-17-16(12-13)20(29-18-4-2-3-5-19(18)30-23(25)26)31-21(28-17)22(32)27-15-9-7-14(24)8-10-15;;/h6-12,18-19H,2-5H2,1H3,(H,27,32)(H4,25,26,30)(H,28,29,31);2*1H/t18-,19?;;/m0../s1 |
| InChIKey | HAVYUNQHLLVVHX-XMWICJOTSA-N |
| XLogP | 4.79 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|