C24H28Cl2N8O3 — CID 68581559
4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)quinazoline-2-carboxamide;dihydrochloride (PubChem CID 68581559) has the molecular formula C24H28Cl2N8O3 and a molecular weight of 547.45 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)quinazoline-2-carboxamide;dihydrochloride.
| Compound Name | 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)quinazoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 68581559 |
| Molecular Formula | C24H28Cl2N8O3 |
| Molecular Weight | 547.45 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)quinazoline-2-carboxamide;dihydrochloride |
| SMILES | Cc1ccc2nc(C(=O)Nc3ccc4oc(=O)[nH]c4c3)nc(N[C@H]3CCCC[C@H]3N=C(N)N)c2c1.Cl.Cl |
| InChI | InChI=1S/C24H26N8O3.2ClH/c1-12-6-8-15-14(10-12)20(29-16-4-2-3-5-17(16)30-23(25)26)32-21(28-15)22(33)27-13-7-9-19-18(11-13)31-24(34)35-19;;/h6-11,16-17H,2-5H2,1H3,(H,27,33)(H,31,34)(H4,25,26,30)(H,28,29,32);2*1H/t16-,17+;;/m0../s1 |
| InChIKey | SCMWCINFBGKUIW-UXHRTOHASA-N |
| XLogP | 3.47 |
| TPSA | 177.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|