C30H33N7O — CID 87505748
N-(4-benzylphenyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide (PubChem CID 87505748) has the molecular formula C30H33N7O and a molecular weight of 507.64 g/mol. Its IUPAC name is N-(4-benzylphenyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide.
| Compound Name | N-(4-benzylphenyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide |
|---|---|
| PubChem CID | 87505748 |
| Molecular Formula | C30H33N7O |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | N-(4-benzylphenyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide |
| SMILES | Cc1ccc2nc(C(=O)Nc3ccc(Cc4ccccc4)cc3)nc(NC3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C30H33N7O/c1-19-11-16-24-23(17-19)27(35-25-9-5-6-10-26(25)36-30(31)32)37-28(34-24)29(38)33-22-14-12-21(13-15-22)18-20-7-3-2-4-8-20/h2-4,7-8,11-17,25-26H,5-6,9-10,18H2,1H3,(H,33,38)(H4,31,32,36)(H,34,35,37) |
| InChIKey | YANXTMDFJGGNFC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|