C26H33N7O — CID 87506238
4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(2-phenylpropyl)quinazoline-2-carboxamide (PubChem CID 87506238) has the molecular formula C26H33N7O and a molecular weight of 459.60 g/mol. Its IUPAC name is 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(2-phenylpropyl)quinazoline-2-carboxamide.
| Compound Name | 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(2-phenylpropyl)quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 87506238 |
| Molecular Formula | C26H33N7O |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(2-phenylpropyl)quinazoline-2-carboxamide |
| SMILES | Cc1ccc2nc(C(=O)NCC(C)c3ccccc3)nc(NC3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C26H33N7O/c1-16-12-13-20-19(14-16)23(31-21-10-6-7-11-22(21)32-26(27)28)33-24(30-20)25(34)29-15-17(2)18-8-4-3-5-9-18/h3-5,8-9,12-14,17,21-22H,6-7,10-11,15H2,1-2H3,(H,29,34)(H4,27,28,32)(H,30,31,33) |
| InChIKey | XHJTXOZUHJXIHJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|