C25H39N7O — CID 87504976
4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-octylquinazoline-2-carboxamide (PubChem CID 87504976) has the molecular formula C25H39N7O and a molecular weight of 453.64 g/mol. Its IUPAC name is 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-octylquinazoline-2-carboxamide.
| Compound Name | 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-octylquinazoline-2-carboxamide |
|---|---|
| PubChem CID | 87504976 |
| Molecular Formula | C25H39N7O |
| Molecular Weight | 453.64 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-octylquinazoline-2-carboxamide |
| SMILES | CCCCCCCCNC(=O)c1nc(NC2CCCCC2N=C(N)N)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C25H39N7O/c1-3-4-5-6-7-10-15-28-24(33)23-29-19-14-13-17(2)16-18(19)22(32-23)30-20-11-8-9-12-21(20)31-25(26)27/h13-14,16,20-21H,3-12,15H2,1-2H3,(H,28,33)(H4,26,27,31)(H,29,30,32) |
| InChIKey | HFHIOOMOECJWKX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|