C22H32N6O — CID 68696717
4-[[(1S,2R)-2-(1-aminoethylideneamino)cyclohexyl]amino]-N-butyl-6-methylquinazoline-2-carboxamide (PubChem CID 68696717) has the molecular formula C22H32N6O and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-(1-aminoethylideneamino)cyclohexyl]amino]-N-butyl-6-methylquinazoline-2-carboxamide.
| Compound Name | 4-[[(1S,2R)-2-(1-aminoethylideneamino)cyclohexyl]amino]-N-butyl-6-methylquinazoline-2-carboxamide |
|---|---|
| PubChem CID | 68696717 |
| Molecular Formula | C22H32N6O |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 4-[[(1S,2R)-2-(1-aminoethylideneamino)cyclohexyl]amino]-N-butyl-6-methylquinazoline-2-carboxamide |
| SMILES | CCCCNC(=O)c1nc(N[C@H]2CCCCC2/N=C(\C)N)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C22H32N6O/c1-4-5-12-24-22(29)21-26-17-11-10-14(2)13-16(17)20(28-21)27-19-9-7-6-8-18(19)25-15(3)23/h10-11,13,18-19H,4-9,12H2,1-3H3,(H2,23,25)(H,24,29)(H,26,27,28)/t18?,19-/m0/s1 |
| InChIKey | AGCXDRYLWBUUPY-GGYWPGCISA-N |
| XLogP | 3.57 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|